C22H19N5O5 — CID 162431824
(1S)-1-[5-[2-methyl-4-[(6-nitroquinazolin-4-yl)amino]phenoxy]-2-pyridinyl]ethane-1,2-diol (PubChem CID 162431824) has the molecular formula C22H19N5O5 and a molecular weight of 433.42 g/mol. Its IUPAC name is (1S)-1-[5-[2-methyl-4-[(6-nitroquinazolin-4-yl)amino]phenoxy]-2-pyridinyl]ethane-1,2-diol.
| Compound Name | (1S)-1-[5-[2-methyl-4-[(6-nitroquinazolin-4-yl)amino]phenoxy]-2-pyridinyl]ethane-1,2-diol |
|---|---|
| PubChem CID | 162431824 |
| Molecular Formula | C22H19N5O5 |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | (1S)-1-[5-[2-methyl-4-[(6-nitroquinazolin-4-yl)amino]phenoxy]-2-pyridinyl]ethane-1,2-diol |
| SMILES | Cc1cc(Nc2ncnc3ccc([N+](=O)[O-])cc23)ccc1Oc1ccc([C@H](O)CO)nc1 |
| InChI | InChI=1S/C22H19N5O5/c1-13-8-14(2-7-21(13)32-16-4-6-19(23-10-16)20(29)11-28)26-22-17-9-15(27(30)31)3-5-18(17)24-12-25-22/h2-10,12,20,28-29H,11H2,1H3,(H,24,25,26)/t20-/m1/s1 |
| InChIKey | KDNXTYYATWRZRU-HXUWFJFHSA-N |
| XLogP | 3.80 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|