C16H15N5O2 — CID 22921757
7-N-ethyl-6-nitro-4-N-phenylquinazoline-4,7-diamine (PubChem CID 22921757) has the molecular formula C16H15N5O2 and a molecular weight of 309.33 g/mol. Its IUPAC name is 7-N-ethyl-6-nitro-4-N-phenylquinazoline-4,7-diamine.
| Compound Name | 7-N-ethyl-6-nitro-4-N-phenylquinazoline-4,7-diamine |
|---|---|
| PubChem CID | 22921757 |
| Molecular Formula | C16H15N5O2 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 7-N-ethyl-6-nitro-4-N-phenylquinazoline-4,7-diamine |
| SMILES | CCNc1cc2ncnc(Nc3ccccc3)c2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H15N5O2/c1-2-17-14-9-13-12(8-15(14)21(22)23)16(19-10-18-13)20-11-6-4-3-5-7-11/h3-10,17H,2H2,1H3,(H,18,19,20) |
| InChIKey | NHGPTXQSDOMIHU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|