C26H26N6O2 — CID 23293018
4-N-[[2-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]methyl]-7-N-ethyl-6-nitroquinazoline-4,7-diamine (PubChem CID 23293018) has the molecular formula C26H26N6O2 and a molecular weight of 454.53 g/mol. Its IUPAC name is 4-N-[[2-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]methyl]-7-N-ethyl-6-nitroquinazoline-4,7-diamine.
| Compound Name | 4-N-[[2-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]methyl]-7-N-ethyl-6-nitroquinazoline-4,7-diamine |
|---|---|
| PubChem CID | 23293018 |
| Molecular Formula | C26H26N6O2 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 4-N-[[2-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]methyl]-7-N-ethyl-6-nitroquinazoline-4,7-diamine |
| SMILES | CCNc1cc2ncnc(NCc3ccccc3N3CCc4ccccc4C3)c2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H26N6O2/c1-2-27-23-14-22-21(13-25(23)32(33)34)26(30-17-29-22)28-15-19-8-5-6-10-24(19)31-12-11-18-7-3-4-9-20(18)16-31/h3-10,13-14,17,27H,2,11-12,15-16H2,1H3,(H,28,29,30) |
| InChIKey | URYGQBBBHOPAJP-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|