C23H27ClN6O3 — CID 11123536
[1-[2-[[[2-chloro-7-(ethylamino)-6-nitroquinazolin-4-yl]amino]methyl]phenyl]piperidin-4-yl]methanol (PubChem CID 11123536) has the molecular formula C23H27ClN6O3 and a molecular weight of 470.96 g/mol. Its IUPAC name is [1-[2-[[[2-chloro-7-(ethylamino)-6-nitroquinazolin-4-yl]amino]methyl]phenyl]piperidin-4-yl]methanol.
| Compound Name | [1-[2-[[[2-chloro-7-(ethylamino)-6-nitroquinazolin-4-yl]amino]methyl]phenyl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 11123536 |
| Molecular Formula | C23H27ClN6O3 |
| Molecular Weight | 470.96 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | [1-[2-[[[2-chloro-7-(ethylamino)-6-nitroquinazolin-4-yl]amino]methyl]phenyl]piperidin-4-yl]methanol |
| SMILES | CCNc1cc2nc(Cl)nc(NCc3ccccc3N3CCC(CO)CC3)c2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H27ClN6O3/c1-2-25-19-12-18-17(11-21(19)30(32)33)22(28-23(24)27-18)26-13-16-5-3-4-6-20(16)29-9-7-15(14-31)8-10-29/h3-6,11-12,15,25,31H,2,7-10,13-14H2,1H3,(H,26,27,28) |
| InChIKey | BVWGYNNRUVOKQW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.96 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|