C30H28N4O2 — CID 18616393
3-[2-[4-(3-methyl-4-phenoxyanilino)quinazolin-6-yl]ethynyl]-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 18616393) has the molecular formula C30H28N4O2 and a molecular weight of 476.58 g/mol. Its IUPAC name is 3-[2-[4-(3-methyl-4-phenoxyanilino)quinazolin-6-yl]ethynyl]-8-azabicyclo[3.2.1]octan-3-ol.
| Compound Name | 3-[2-[4-(3-methyl-4-phenoxyanilino)quinazolin-6-yl]ethynyl]-8-azabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 18616393 |
| Molecular Formula | C30H28N4O2 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | 3-[2-[4-(3-methyl-4-phenoxyanilino)quinazolin-6-yl]ethynyl]-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | Cc1cc(Nc2ncnc3ccc(C#CC4(O)CC5CCC(C4)N5)cc23)ccc1Oc1ccccc1 |
| InChI | InChI=1S/C30H28N4O2/c1-20-15-22(10-12-28(20)36-25-5-3-2-4-6-25)34-29-26-16-21(7-11-27(26)31-19-32-29)13-14-30(35)17-23-8-9-24(18-30)33-23/h2-7,10-12,15-16,19,23-24,33,35H,8-9,17-18H2,1H3,(H,31,32,34) |
| InChIKey | CKPXQVILGNKODG-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 79.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|