C26H18N4O — CID 169222963
6-ethynyl-N-(3-methyl-4-quinolin-8-yloxyphenyl)quinazolin-4-amine (PubChem CID 169222963) has the molecular formula C26H18N4O and a molecular weight of 402.46 g/mol. Its IUPAC name is 6-ethynyl-N-(3-methyl-4-quinolin-8-yloxyphenyl)quinazolin-4-amine.
| Compound Name | 6-ethynyl-N-(3-methyl-4-quinolin-8-yloxyphenyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 169222963 |
| Molecular Formula | C26H18N4O |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 6-ethynyl-N-(3-methyl-4-quinolin-8-yloxyphenyl)quinazolin-4-amine |
| SMILES | C#Cc1ccc2ncnc(Nc3ccc(Oc4cccc5cccnc45)c(C)c3)c2c1 |
| InChI | InChI=1S/C26H18N4O/c1-3-18-9-11-22-21(15-18)26(29-16-28-22)30-20-10-12-23(17(2)14-20)31-24-8-4-6-19-7-5-13-27-25(19)24/h1,4-16H,2H3,(H,28,29,30) |
| InChIKey | JNXPOJMTEXKVHW-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|