C30H30N4O6 — CID 162788069
6,7-bis(2-methoxyethoxy)-N-(3-methoxy-4-quinolin-8-yloxyphenyl)quinazolin-4-amine (PubChem CID 162788069) has the molecular formula C30H30N4O6 and a molecular weight of 542.59 g/mol. Its IUPAC name is 6,7-bis(2-methoxyethoxy)-N-(3-methoxy-4-quinolin-8-yloxyphenyl)quinazolin-4-amine.
| Compound Name | 6,7-bis(2-methoxyethoxy)-N-(3-methoxy-4-quinolin-8-yloxyphenyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 162788069 |
| Molecular Formula | C30H30N4O6 |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | 6,7-bis(2-methoxyethoxy)-N-(3-methoxy-4-quinolin-8-yloxyphenyl)quinazolin-4-amine |
| SMILES | COCCOc1cc2ncnc(Nc3ccc(Oc4cccc5cccnc45)c(OC)c3)c2cc1OCCOC |
| InChI | InChI=1S/C30H30N4O6/c1-35-12-14-38-27-17-22-23(18-28(27)39-15-13-36-2)32-19-33-30(22)34-21-9-10-24(26(16-21)37-3)40-25-8-4-6-20-7-5-11-31-29(20)25/h4-11,16-19H,12-15H2,1-3H3,(H,32,33,34) |
| InChIKey | WYDMKSVXPKQHOW-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 106.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|