C33H36ClFN6O3 — CID 72541700
N-[3-[[6-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]pyrimidin-4-yl]amino]phenyl]-4-[methyl(2-propoxyethyl)amino]but-2-enamide (PubChem CID 72541700) has the molecular formula C33H36ClFN6O3 and a molecular weight of 619.14 g/mol. Its IUPAC name is N-[3-[[6-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]pyrimidin-4-yl]amino]phenyl]-4-[methyl(2-propoxyethyl)amino]but-2-enamide.
| Compound Name | N-[3-[[6-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]pyrimidin-4-yl]amino]phenyl]-4-[methyl(2-propoxyethyl)amino]but-2-enamide |
|---|---|
| PubChem CID | 72541700 |
| Molecular Formula | C33H36ClFN6O3 |
| Molecular Weight | 619.14 g/mol |
| Exact Mass | 618.25 |
| IUPAC Name | N-[3-[[6-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]pyrimidin-4-yl]amino]phenyl]-4-[methyl(2-propoxyethyl)amino]but-2-enamide |
| SMILES | CCCOCCN(C)CC=CC(=O)Nc1cccc(Nc2cc(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)ncn2)c1 |
| InChI | InChI=1S/C33H36ClFN6O3/c1-3-16-43-17-15-41(2)14-6-11-33(42)40-27-10-5-9-26(19-27)38-31-21-32(37-23-36-31)39-28-12-13-30(29(34)20-28)44-22-24-7-4-8-25(35)18-24/h4-13,18-21,23H,3,14-17,22H2,1-2H3,(H,40,42)(H2,36,37,38,39) |
| InChIKey | JTLHZQFJJXQDLG-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 100.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.14 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|