C23H21ClFN3O3 — CID 143305255
ethyl (E)-3-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-6-methylpyrimidin-5-yl]prop-2-enoate (PubChem CID 143305255) has the molecular formula C23H21ClFN3O3 and a molecular weight of 441.89 g/mol. Its IUPAC name is ethyl (E)-3-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-6-methylpyrimidin-5-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-6-methylpyrimidin-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 143305255 |
| Molecular Formula | C23H21ClFN3O3 |
| Molecular Weight | 441.89 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | ethyl (E)-3-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-6-methylpyrimidin-5-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1c(C)ncnc1Nc1ccc(OCc2cccc(F)c2)c(Cl)c1 |
| InChI | InChI=1S/C23H21ClFN3O3/c1-3-30-22(29)10-8-19-15(2)26-14-27-23(19)28-18-7-9-21(20(24)12-18)31-13-16-5-4-6-17(25)11-16/h4-12,14H,3,13H2,1-2H3,(H,26,27,28)/b10-8+ |
| InChIKey | GUNSMQBJPRGPQO-CSKARUKUSA-N |
| XLogP | 5.48 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.89 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|