C30H25ClFN5O4 — CID 87361177
N-[3-[[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]amino]-3-oxopropyl]-6-oxohexa-2,4-dienamide (PubChem CID 87361177) has the molecular formula C30H25ClFN5O4 and a molecular weight of 574.01 g/mol. Its IUPAC name is N-[3-[[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]amino]-3-oxopropyl]-6-oxohexa-2,4-dienamide.
| Compound Name | N-[3-[[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]amino]-3-oxopropyl]-6-oxohexa-2,4-dienamide |
|---|---|
| PubChem CID | 87361177 |
| Molecular Formula | C30H25ClFN5O4 |
| Molecular Weight | 574.01 g/mol |
| Exact Mass | 573.16 |
| IUPAC Name | N-[3-[[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]amino]-3-oxopropyl]-6-oxohexa-2,4-dienamide |
| SMILES | O=CC=CC=CC(=O)NCCC(=O)Nc1ccc2ncnc(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C30H25ClFN5O4/c31-25-17-23(9-11-27(25)41-18-20-5-4-6-21(32)15-20)37-30-24-16-22(8-10-26(24)34-19-35-30)36-29(40)12-13-33-28(39)7-2-1-3-14-38/h1-11,14-17,19H,12-13,18H2,(H,33,39)(H,36,40)(H,34,35,37) |
| InChIKey | BRXGSZGZBYEZGR-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 122.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.01 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|