C28H29N7O2 — CID 123310278
4-(dimethylamino)-N-[6-[[6-(4-phenoxyanilino)pyrimidin-4-yl]amino]-2-pyridinyl]pent-2-enamide (PubChem CID 123310278) has the molecular formula C28H29N7O2 and a molecular weight of 495.59 g/mol. Its IUPAC name is 4-(dimethylamino)-N-[6-[[6-(4-phenoxyanilino)pyrimidin-4-yl]amino]-2-pyridinyl]pent-2-enamide.
| Compound Name | 4-(dimethylamino)-N-[6-[[6-(4-phenoxyanilino)pyrimidin-4-yl]amino]-2-pyridinyl]pent-2-enamide |
|---|---|
| PubChem CID | 123310278 |
| Molecular Formula | C28H29N7O2 |
| Molecular Weight | 495.59 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | 4-(dimethylamino)-N-[6-[[6-(4-phenoxyanilino)pyrimidin-4-yl]amino]-2-pyridinyl]pent-2-enamide |
| SMILES | CC(C=CC(=O)Nc1cccc(Nc2cc(Nc3ccc(Oc4ccccc4)cc3)ncn2)n1)N(C)C |
| InChI | InChI=1S/C28H29N7O2/c1-20(35(2)3)12-17-28(36)34-25-11-7-10-24(32-25)33-27-18-26(29-19-30-27)31-21-13-15-23(16-14-21)37-22-8-5-4-6-9-22/h4-20H,1-3H3,(H3,29,30,31,32,33,34,36) |
| InChIKey | NRRXZRNKFWONAD-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 104.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.59 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|