C21H18N6O — CID 58442794
4-N-(6-amino-2-pyridinyl)-6-N-(3-phenoxyphenyl)pyrimidine-4,6-diamine (PubChem CID 58442794) has the molecular formula C21H18N6O and a molecular weight of 370.42 g/mol. Its IUPAC name is 4-N-(6-amino-2-pyridinyl)-6-N-(3-phenoxyphenyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-(6-amino-2-pyridinyl)-6-N-(3-phenoxyphenyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 58442794 |
| Molecular Formula | C21H18N6O |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 4-N-(6-amino-2-pyridinyl)-6-N-(3-phenoxyphenyl)pyrimidine-4,6-diamine |
| SMILES | Nc1cccc(Nc2cc(Nc3cccc(Oc4ccccc4)c3)ncn2)n1 |
| InChI | InChI=1S/C21H18N6O/c22-18-10-5-11-19(26-18)27-21-13-20(23-14-24-21)25-15-6-4-9-17(12-15)28-16-7-2-1-3-8-16/h1-14H,(H4,22,23,24,25,26,27) |
| InChIKey | TZKYXOKRJMGEQW-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |