C23H19BN4O2S — CID 58434670
1-N-(oxaboriran-2-yl)-3-N-[6-(4-phenoxyphenyl)sulfanylpyrimidin-4-yl]benzene-1,3-diamine (PubChem CID 58434670) has the molecular formula C23H19BN4O2S and a molecular weight of 426.31 g/mol. Its IUPAC name is 1-N-(oxaboriran-2-yl)-3-N-[6-(4-phenoxyphenyl)sulfanylpyrimidin-4-yl]benzene-1,3-diamine.
| Compound Name | 1-N-(oxaboriran-2-yl)-3-N-[6-(4-phenoxyphenyl)sulfanylpyrimidin-4-yl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 58434670 |
| Molecular Formula | C23H19BN4O2S |
| Molecular Weight | 426.31 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 1-N-(oxaboriran-2-yl)-3-N-[6-(4-phenoxyphenyl)sulfanylpyrimidin-4-yl]benzene-1,3-diamine |
| SMILES | c1ccc(Oc2ccc(Sc3cc(Nc4cccc(NB5CO5)c4)ncn3)cc2)cc1 |
| InChI | InChI=1S/C23H19BN4O2S/c1-2-7-19(8-3-1)30-20-9-11-21(12-10-20)31-23-14-22(25-16-26-23)27-17-5-4-6-18(13-17)28-24-15-29-24/h1-14,16,28H,15H2,(H,25,26,27) |
| InChIKey | PNUUHDFVBKYVCN-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 71.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.31 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|