C28H27N4O2S+ — CID 91439976
N-[3-[[6-(4-phenoxyphenyl)sulfanyl-3-propylpyrimidin-3-ium-4-yl]amino]phenyl]prop-2-enamide (PubChem CID 91439976) has the molecular formula C28H27N4O2S+ and a molecular weight of 483.62 g/mol. Its IUPAC name is N-[3-[[6-(4-phenoxyphenyl)sulfanyl-3-propylpyrimidin-3-ium-4-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[6-(4-phenoxyphenyl)sulfanyl-3-propylpyrimidin-3-ium-4-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 91439976 |
| Molecular Formula | C28H27N4O2S+ |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | N-[3-[[6-(4-phenoxyphenyl)sulfanyl-3-propylpyrimidin-3-ium-4-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Nc2cc(Sc3ccc(Oc4ccccc4)cc3)nc[n+]2CCC)c1 |
| InChI | InChI=1S/C28H26N4O2S/c1-3-17-32-20-29-28(19-26(32)30-21-9-8-10-22(18-21)31-27(33)4-2)35-25-15-13-24(14-16-25)34-23-11-6-5-7-12-23/h4-16,18-20H,2-3,17H2,1H3,(H,31,33)/p+1 |
| InChIKey | GACZQZNHMSRTPE-UHFFFAOYSA-O |
| XLogP | 6.59 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|