C29H29N7O4S — CID 73438217
4-[4-[[5-(2-methoxyethylsulfanyl)-4-[3-(prop-2-enoylamino)anilino]pyrimidin-2-yl]amino]phenoxy]-N-methylpyridine-2-carboxamide (PubChem CID 73438217) has the molecular formula C29H29N7O4S and a molecular weight of 571.66 g/mol. Its IUPAC name is 4-[4-[[5-(2-methoxyethylsulfanyl)-4-[3-(prop-2-enoylamino)anilino]pyrimidin-2-yl]amino]phenoxy]-N-methylpyridine-2-carboxamide.
| Compound Name | 4-[4-[[5-(2-methoxyethylsulfanyl)-4-[3-(prop-2-enoylamino)anilino]pyrimidin-2-yl]amino]phenoxy]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 73438217 |
| Molecular Formula | C29H29N7O4S |
| Molecular Weight | 571.66 g/mol |
| Exact Mass | 571.20 |
| IUPAC Name | 4-[4-[[5-(2-methoxyethylsulfanyl)-4-[3-(prop-2-enoylamino)anilino]pyrimidin-2-yl]amino]phenoxy]-N-methylpyridine-2-carboxamide |
| SMILES | C=CC(=O)Nc1cccc(Nc2nc(Nc3ccc(Oc4ccnc(C(=O)NC)c4)cc3)ncc2SCCOC)c1 |
| InChI | InChI=1S/C29H29N7O4S/c1-4-26(37)33-20-6-5-7-21(16-20)34-27-25(41-15-14-39-3)18-32-29(36-27)35-19-8-10-22(11-9-19)40-23-12-13-31-24(17-23)28(38)30-2/h4-13,16-18H,1,14-15H2,2-3H3,(H,30,38)(H,33,37)(H2,32,34,35,36) |
| InChIKey | JMBZFXZHGXKBKU-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 139.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.66 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|