C28H27N7O3S — CID 144587275
N-methyl-4-[4-[[5-[methyl(methylidene)-λ4-sulfanyl]-4-[3-(prop-2-enoylamino)anilino]pyrimidin-2-yl]amino]phenoxy]pyridine-2-carboxamide (PubChem CID 144587275) has the molecular formula C28H27N7O3S and a molecular weight of 541.64 g/mol. Its IUPAC name is N-methyl-4-[4-[[5-[methyl(methylidene)-λ4-sulfanyl]-4-[3-(prop-2-enoylamino)anilino]pyrimidin-2-yl]amino]phenoxy]pyridine-2-carboxamide.
| Compound Name | N-methyl-4-[4-[[5-[methyl(methylidene)-λ4-sulfanyl]-4-[3-(prop-2-enoylamino)anilino]pyrimidin-2-yl]amino]phenoxy]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 144587275 |
| Molecular Formula | C28H27N7O3S |
| Molecular Weight | 541.64 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | N-methyl-4-[4-[[5-[methyl(methylidene)-λ4-sulfanyl]-4-[3-(prop-2-enoylamino)anilino]pyrimidin-2-yl]amino]phenoxy]pyridine-2-carboxamide |
| SMILES | C=CC(=O)Nc1cccc(Nc2nc(Nc3ccc(Oc4ccnc(C(=O)NC)c4)cc3)ncc2S(=C)C)c1 |
| InChI | InChI=1S/C28H27N7O3S/c1-5-25(36)32-19-7-6-8-20(15-19)33-26-24(39(3)4)17-31-28(35-26)34-18-9-11-21(12-10-18)38-22-13-14-30-23(16-22)27(37)29-2/h5-17H,1,3H2,2,4H3,(H,29,37)(H,32,36)(H2,31,33,34,35) |
| InChIKey | VBEXOEDDJNOZEW-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.64 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|