C26H25N5O3 — CID 58434697
4-morpholin-4-yl-1-N-[6-(4-phenoxyphenoxy)pyrimidin-4-yl]benzene-1,3-diamine (PubChem CID 58434697) has the molecular formula C26H25N5O3 and a molecular weight of 455.52 g/mol. Its IUPAC name is 4-morpholin-4-yl-1-N-[6-(4-phenoxyphenoxy)pyrimidin-4-yl]benzene-1,3-diamine.
| Compound Name | 4-morpholin-4-yl-1-N-[6-(4-phenoxyphenoxy)pyrimidin-4-yl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 58434697 |
| Molecular Formula | C26H25N5O3 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | 4-morpholin-4-yl-1-N-[6-(4-phenoxyphenoxy)pyrimidin-4-yl]benzene-1,3-diamine |
| SMILES | Nc1cc(Nc2cc(Oc3ccc(Oc4ccccc4)cc3)ncn2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C26H25N5O3/c27-23-16-19(6-11-24(23)31-12-14-32-15-13-31)30-25-17-26(29-18-28-25)34-22-9-7-21(8-10-22)33-20-4-2-1-3-5-20/h1-11,16-18H,12-15,27H2,(H,28,29,30) |
| InChIKey | HMYPZMVXXDZTKO-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 94.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|