C28H25F3N6O4 — CID 58659418
1-[4-[6-(4-hydroxyanilino)pyrimidin-4-yl]oxyphenyl]-3-[4-morpholin-4-yl-3-(trifluoromethyl)phenyl]urea (PubChem CID 58659418) has the molecular formula C28H25F3N6O4 and a molecular weight of 566.54 g/mol. Its IUPAC name is 1-[4-[6-(4-hydroxyanilino)pyrimidin-4-yl]oxyphenyl]-3-[4-morpholin-4-yl-3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-[6-(4-hydroxyanilino)pyrimidin-4-yl]oxyphenyl]-3-[4-morpholin-4-yl-3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 58659418 |
| Molecular Formula | C28H25F3N6O4 |
| Molecular Weight | 566.54 g/mol |
| Exact Mass | 566.19 |
| IUPAC Name | 1-[4-[6-(4-hydroxyanilino)pyrimidin-4-yl]oxyphenyl]-3-[4-morpholin-4-yl-3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(Oc2cc(Nc3ccc(O)cc3)ncn2)cc1)Nc1ccc(N2CCOCC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H25F3N6O4/c29-28(30,31)23-15-20(5-10-24(23)37-11-13-40-14-12-37)36-27(39)35-19-3-8-22(9-4-19)41-26-16-25(32-17-33-26)34-18-1-6-21(38)7-2-18/h1-10,15-17,38H,11-14H2,(H,32,33,34)(H2,35,36,39) |
| InChIKey | WGTQRWXKSITTDP-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 120.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.54 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|