C28H28F3N7O3 — CID 151856666
5-(6-acetamidopyrimidin-4-yl)oxy-N-[4-[3-(dimethylamino)pyrrolidin-1-yl]-3-(trifluoromethyl)phenyl]indole-1-carboxamide (PubChem CID 151856666) has the molecular formula C28H28F3N7O3 and a molecular weight of 567.57 g/mol. Its IUPAC name is 5-(6-acetamidopyrimidin-4-yl)oxy-N-[4-[3-(dimethylamino)pyrrolidin-1-yl]-3-(trifluoromethyl)phenyl]indole-1-carboxamide.
| Compound Name | 5-(6-acetamidopyrimidin-4-yl)oxy-N-[4-[3-(dimethylamino)pyrrolidin-1-yl]-3-(trifluoromethyl)phenyl]indole-1-carboxamide |
|---|---|
| PubChem CID | 151856666 |
| Molecular Formula | C28H28F3N7O3 |
| Molecular Weight | 567.57 g/mol |
| Exact Mass | 567.22 |
| IUPAC Name | 5-(6-acetamidopyrimidin-4-yl)oxy-N-[4-[3-(dimethylamino)pyrrolidin-1-yl]-3-(trifluoromethyl)phenyl]indole-1-carboxamide |
| SMILES | CC(=O)Nc1cc(Oc2ccc3c(ccn3C(=O)Nc3ccc(N4CCC(N(C)C)C4)c(C(F)(F)F)c3)c2)ncn1 |
| InChI | InChI=1S/C28H28F3N7O3/c1-17(39)34-25-14-26(33-16-32-25)41-21-5-7-23-18(12-21)8-11-38(23)27(40)35-19-4-6-24(22(13-19)28(29,30)31)37-10-9-20(15-37)36(2)3/h4-8,11-14,16,20H,9-10,15H2,1-3H3,(H,35,40)(H,32,33,34,39) |
| InChIKey | SJVFQWQJAVEDRT-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 104.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.57 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|