C23H20F4N8O2 — CID 129044859
5-[6-[[amino-[(Z)-1-aminoethylideneamino]amino]methyl]pyrimidin-4-yl]oxy-N-[4-fluoro-3-(trifluoromethyl)phenyl]indole-1-carboxamide (PubChem CID 129044859) has the molecular formula C23H20F4N8O2 and a molecular weight of 516.46 g/mol. Its IUPAC name is 5-[6-[[amino-[(Z)-1-aminoethylideneamino]amino]methyl]pyrimidin-4-yl]oxy-N-[4-fluoro-3-(trifluoromethyl)phenyl]indole-1-carboxamide.
| Compound Name | 5-[6-[[amino-[(Z)-1-aminoethylideneamino]amino]methyl]pyrimidin-4-yl]oxy-N-[4-fluoro-3-(trifluoromethyl)phenyl]indole-1-carboxamide |
|---|---|
| PubChem CID | 129044859 |
| Molecular Formula | C23H20F4N8O2 |
| Molecular Weight | 516.46 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | 5-[6-[[amino-[(Z)-1-aminoethylideneamino]amino]methyl]pyrimidin-4-yl]oxy-N-[4-fluoro-3-(trifluoromethyl)phenyl]indole-1-carboxamide |
| SMILES | C/C(N)=N/N(N)Cc1cc(Oc2ccc3c(ccn3C(=O)Nc3ccc(F)c(C(F)(F)F)c3)c2)ncn1 |
| InChI | InChI=1S/C23H20F4N8O2/c1-13(28)33-35(29)11-16-10-21(31-12-30-16)37-17-3-5-20-14(8-17)6-7-34(20)22(36)32-15-2-4-19(24)18(9-15)23(25,26)27/h2-10,12H,11,29H2,1H3,(H2,28,33)(H,32,36) |
| InChIKey | AGNBDUFCBSSTQS-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.46 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|