C22H16F4N4O3S — CID 129044998
N-[2-fluoro-5-(trifluoromethyl)phenyl]-5-[6-(methylsulfanyloxymethyl)pyrimidin-4-yl]oxyindole-1-carboxamide (PubChem CID 129044998) has the molecular formula C22H16F4N4O3S and a molecular weight of 492.45 g/mol. Its IUPAC name is N-[2-fluoro-5-(trifluoromethyl)phenyl]-5-[6-(methylsulfanyloxymethyl)pyrimidin-4-yl]oxyindole-1-carboxamide.
| Compound Name | N-[2-fluoro-5-(trifluoromethyl)phenyl]-5-[6-(methylsulfanyloxymethyl)pyrimidin-4-yl]oxyindole-1-carboxamide |
|---|---|
| PubChem CID | 129044998 |
| Molecular Formula | C22H16F4N4O3S |
| Molecular Weight | 492.45 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | N-[2-fluoro-5-(trifluoromethyl)phenyl]-5-[6-(methylsulfanyloxymethyl)pyrimidin-4-yl]oxyindole-1-carboxamide |
| SMILES | CSOCc1cc(Oc2ccc3c(ccn3C(=O)Nc3cc(C(F)(F)F)ccc3F)c2)ncn1 |
| InChI | InChI=1S/C22H16F4N4O3S/c1-34-32-11-15-10-20(28-12-27-15)33-16-3-5-19-13(8-16)6-7-30(19)21(31)29-18-9-14(22(24,25)26)2-4-17(18)23/h2-10,12H,11H2,1H3,(H,29,31) |
| InChIKey | KAUPKYDCEDUTSE-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.45 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|