C35H31F3N6O3 — CID 23652645
6-(6-acetamidopyrimidin-4-yl)oxy-N-[4-(4-benzylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]naphthalene-1-carboxamide (PubChem CID 23652645) has the molecular formula C35H31F3N6O3 and a molecular weight of 640.67 g/mol. Its IUPAC name is 6-(6-acetamidopyrimidin-4-yl)oxy-N-[4-(4-benzylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]naphthalene-1-carboxamide.
| Compound Name | 6-(6-acetamidopyrimidin-4-yl)oxy-N-[4-(4-benzylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 23652645 |
| Molecular Formula | C35H31F3N6O3 |
| Molecular Weight | 640.67 g/mol |
| Exact Mass | 640.24 |
| IUPAC Name | 6-(6-acetamidopyrimidin-4-yl)oxy-N-[4-(4-benzylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]naphthalene-1-carboxamide |
| SMILES | CC(=O)Nc1cc(Oc2ccc3c(C(=O)Nc4ccc(N5CCN(Cc6ccccc6)CC5)c(C(F)(F)F)c4)cccc3c2)ncn1 |
| InChI | InChI=1S/C35H31F3N6O3/c1-23(45)41-32-20-33(40-22-39-32)47-27-11-12-28-25(18-27)8-5-9-29(28)34(46)42-26-10-13-31(30(19-26)35(36,37)38)44-16-14-43(15-17-44)21-24-6-3-2-4-7-24/h2-13,18-20,22H,14-17,21H2,1H3,(H,42,46)(H,39,40,41,45) |
| InChIKey | XMWKQXIOYWKEFN-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.67 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|