C27H25F3N6O2 — CID 90894187
6-(6-aminopyrimidin-4-yl)oxy-N-[2-methyl-4-piperazin-1-yl-3-(trifluoromethyl)phenyl]naphthalene-1-carboxamide (PubChem CID 90894187) has the molecular formula C27H25F3N6O2 and a molecular weight of 522.53 g/mol. Its IUPAC name is 6-(6-aminopyrimidin-4-yl)oxy-N-[2-methyl-4-piperazin-1-yl-3-(trifluoromethyl)phenyl]naphthalene-1-carboxamide.
| Compound Name | 6-(6-aminopyrimidin-4-yl)oxy-N-[2-methyl-4-piperazin-1-yl-3-(trifluoromethyl)phenyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 90894187 |
| Molecular Formula | C27H25F3N6O2 |
| Molecular Weight | 522.53 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | 6-(6-aminopyrimidin-4-yl)oxy-N-[2-methyl-4-piperazin-1-yl-3-(trifluoromethyl)phenyl]naphthalene-1-carboxamide |
| SMILES | Cc1c(NC(=O)c2cccc3cc(Oc4cc(N)ncn4)ccc23)ccc(N2CCNCC2)c1C(F)(F)F |
| InChI | InChI=1S/C27H25F3N6O2/c1-16-21(7-8-22(25(16)27(28,29)30)36-11-9-32-10-12-36)35-26(37)20-4-2-3-17-13-18(5-6-19(17)20)38-24-14-23(31)33-15-34-24/h2-8,13-15,32H,9-12H2,1H3,(H,35,37)(H2,31,33,34) |
| InChIKey | FZXWAPONSKOJCW-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.53 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|