C24H17BF3N3O3 — CID 178083953
CID 178083953 (PubChem CID 178083953) has the molecular formula C24H17BF3N3O3 and a molecular weight of 463.22 g/mol.
| Compound Name | CID 178083953 |
|---|---|
| PubChem CID | 178083953 |
| Molecular Formula | C24H17BF3N3O3 |
| Molecular Weight | 463.22 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(CC(F)(F)F)cc1NC(=O)c1cccc2cc(Oc3cc(CO)ncn3)ccc12 |
| InChI | InChI=1S/C24H17BF3N3O3/c25-20-7-4-14(11-24(26,27)28)8-21(20)31-23(33)19-3-1-2-15-9-17(5-6-18(15)19)34-22-10-16(12-32)29-13-30-22/h1-10,13,32H,11-12H2,(H,31,33) |
| InChIKey | JSXQOBVPICERDY-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.22 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|