C25H22ClF3N6O3 — CID 52945153
1-[2-chloro-4-(5-methylpyrrolo[3,2-d]pyrimidin-4-yl)oxyphenyl]-3-[4-morpholin-4-yl-3-(trifluoromethyl)phenyl]urea (PubChem CID 52945153) has the molecular formula C25H22ClF3N6O3 and a molecular weight of 546.94 g/mol. Its IUPAC name is 1-[2-chloro-4-(5-methylpyrrolo[3,2-d]pyrimidin-4-yl)oxyphenyl]-3-[4-morpholin-4-yl-3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[2-chloro-4-(5-methylpyrrolo[3,2-d]pyrimidin-4-yl)oxyphenyl]-3-[4-morpholin-4-yl-3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 52945153 |
| Molecular Formula | C25H22ClF3N6O3 |
| Molecular Weight | 546.94 g/mol |
| Exact Mass | 546.14 |
| IUPAC Name | 1-[2-chloro-4-(5-methylpyrrolo[3,2-d]pyrimidin-4-yl)oxyphenyl]-3-[4-morpholin-4-yl-3-(trifluoromethyl)phenyl]urea |
| SMILES | Cn1ccc2ncnc(Oc3ccc(NC(=O)Nc4ccc(N5CCOCC5)c(C(F)(F)F)c4)c(Cl)c3)c21 |
| InChI | InChI=1S/C25H22ClF3N6O3/c1-34-7-6-20-22(34)23(31-14-30-20)38-16-3-4-19(18(26)13-16)33-24(36)32-15-2-5-21(17(12-15)25(27,28)29)35-8-10-37-11-9-35/h2-7,12-14H,8-11H2,1H3,(H2,32,33,36) |
| InChIKey | LPJWLEWNHDOAQS-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 93.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.94 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|