C24H21N3O2 — CID 59681549
4-(3-amino-4-methoxyphenyl)-N-(3-phenoxyphenyl)pyridin-2-amine (PubChem CID 59681549) has the molecular formula C24H21N3O2 and a molecular weight of 383.45 g/mol. Its IUPAC name is 4-(3-amino-4-methoxyphenyl)-N-(3-phenoxyphenyl)pyridin-2-amine.
| Compound Name | 4-(3-amino-4-methoxyphenyl)-N-(3-phenoxyphenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 59681549 |
| Molecular Formula | C24H21N3O2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 4-(3-amino-4-methoxyphenyl)-N-(3-phenoxyphenyl)pyridin-2-amine |
| SMILES | COc1ccc(-c2ccnc(Nc3cccc(Oc4ccccc4)c3)c2)cc1N |
| InChI | InChI=1S/C24H21N3O2/c1-28-23-11-10-17(14-22(23)25)18-12-13-26-24(15-18)27-19-6-5-9-21(16-19)29-20-7-3-2-4-8-20/h2-16H,25H2,1H3,(H,26,27) |
| InChIKey | HDARJTWCKINTQH-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|