C30H27ClN8O2 — CID 123296452
N-[3-[[5-chloro-4-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrimidin-2-yl]amino]phenyl]-4-[4-(dimethylamino)but-2-enoylamino]benzamide (PubChem CID 123296452) has the molecular formula C30H27ClN8O2 and a molecular weight of 567.05 g/mol. Its IUPAC name is N-[3-[[5-chloro-4-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrimidin-2-yl]amino]phenyl]-4-[4-(dimethylamino)but-2-enoylamino]benzamide.
| Compound Name | N-[3-[[5-chloro-4-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrimidin-2-yl]amino]phenyl]-4-[4-(dimethylamino)but-2-enoylamino]benzamide |
|---|---|
| PubChem CID | 123296452 |
| Molecular Formula | C30H27ClN8O2 |
| Molecular Weight | 567.05 g/mol |
| Exact Mass | 566.19 |
| IUPAC Name | N-[3-[[5-chloro-4-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrimidin-2-yl]amino]phenyl]-4-[4-(dimethylamino)but-2-enoylamino]benzamide |
| SMILES | CN(C)CC=CC(=O)Nc1ccc(C(=O)Nc2cccc(Nc3ncc(Cl)c(-c4cnc5[nH]ccc5c4)n3)c2)cc1 |
| InChI | InChI=1S/C30H27ClN8O2/c1-39(2)14-4-7-26(40)35-22-10-8-19(9-11-22)29(41)36-23-5-3-6-24(16-23)37-30-34-18-25(31)27(38-30)21-15-20-12-13-32-28(20)33-17-21/h3-13,15-18H,14H2,1-2H3,(H,32,33)(H,35,40)(H,36,41)(H,34,37,38) |
| InChIKey | QOPLZGZOVVLAOF-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 127.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.05 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|