C29H29BrClN7O2 — CID 175190082
N-[3-[[4-(3-bromoanilino)-5-chloropyrimidin-2-yl]amino]phenyl]benzamide;(E)-4-(dimethylamino)but-2-enamide (PubChem CID 175190082) has the molecular formula C29H29BrClN7O2 and a molecular weight of 622.96 g/mol. Its IUPAC name is N-[3-[[4-(3-bromoanilino)-5-chloropyrimidin-2-yl]amino]phenyl]benzamide;(E)-4-(dimethylamino)but-2-enamide.
| Compound Name | N-[3-[[4-(3-bromoanilino)-5-chloropyrimidin-2-yl]amino]phenyl]benzamide;(E)-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 175190082 |
| Molecular Formula | C29H29BrClN7O2 |
| Molecular Weight | 622.96 g/mol |
| Exact Mass | 621.13 |
| IUPAC Name | N-[3-[[4-(3-bromoanilino)-5-chloropyrimidin-2-yl]amino]phenyl]benzamide;(E)-4-(dimethylamino)but-2-enamide |
| SMILES | CN(C)C/C=C/C(N)=O.O=C(Nc1cccc(Nc2ncc(Cl)c(Nc3cccc(Br)c3)n2)c1)c1ccccc1 |
| InChI | InChI=1S/C23H17BrClN5O.C6H12N2O/c24-16-8-4-9-17(12-16)27-21-20(25)14-26-23(30-21)29-19-11-5-10-18(13-19)28-22(31)15-6-2-1-3-7-15;1-8(2)5-3-4-6(7)9/h1-14H,(H,28,31)(H2,26,27,29,30);3-4H,5H2,1-2H3,(H2,7,9)/b;4-3+ |
| InChIKey | FNLXKXLPZRUODX-SCBDLNNBSA-N |
| XLogP | 6.22 |
| TPSA | 125.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.96 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|