C24H26ClN7O2 — CID 127039836
(E)-N-[3-[[5-chloro-2-[(2E)-2-[(4-methoxyphenyl)methylidene]hydrazinyl]pyrimidin-4-yl]amino]phenyl]-4-(dimethylamino)but-2-enamide (PubChem CID 127039836) has the molecular formula C24H26ClN7O2 and a molecular weight of 479.97 g/mol. Its IUPAC name is (E)-N-[3-[[5-chloro-2-[(2E)-2-[(4-methoxyphenyl)methylidene]hydrazinyl]pyrimidin-4-yl]amino]phenyl]-4-(dimethylamino)but-2-enamide.
| Compound Name | (E)-N-[3-[[5-chloro-2-[(2E)-2-[(4-methoxyphenyl)methylidene]hydrazinyl]pyrimidin-4-yl]amino]phenyl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 127039836 |
| Molecular Formula | C24H26ClN7O2 |
| Molecular Weight | 479.97 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | (E)-N-[3-[[5-chloro-2-[(2E)-2-[(4-methoxyphenyl)methylidene]hydrazinyl]pyrimidin-4-yl]amino]phenyl]-4-(dimethylamino)but-2-enamide |
| SMILES | COc1ccc(/C=N/Nc2ncc(Cl)c(Nc3cccc(NC(=O)/C=C/CN(C)C)c3)n2)cc1 |
| InChI | InChI=1S/C24H26ClN7O2/c1-32(2)13-5-8-22(33)28-18-6-4-7-19(14-18)29-23-21(25)16-26-24(30-23)31-27-15-17-9-11-20(34-3)12-10-17/h4-12,14-16H,13H2,1-3H3,(H,28,33)(H2,26,29,30,31)/b8-5+,27-15+ |
| InChIKey | SFIFWQUIDPMVRP-NJBUXCONSA-N |
| XLogP | 4.38 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.97 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|