C26H25BrN6O — CID 130472936
(E)-N-[2-[[5-bromo-4-(naphthalen-2-ylamino)pyrimidin-2-yl]amino]phenyl]-4-(dimethylamino)but-2-enamide (PubChem CID 130472936) has the molecular formula C26H25BrN6O and a molecular weight of 517.43 g/mol. Its IUPAC name is (E)-N-[2-[[5-bromo-4-(naphthalen-2-ylamino)pyrimidin-2-yl]amino]phenyl]-4-(dimethylamino)but-2-enamide.
| Compound Name | (E)-N-[2-[[5-bromo-4-(naphthalen-2-ylamino)pyrimidin-2-yl]amino]phenyl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 130472936 |
| Molecular Formula | C26H25BrN6O |
| Molecular Weight | 517.43 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | (E)-N-[2-[[5-bromo-4-(naphthalen-2-ylamino)pyrimidin-2-yl]amino]phenyl]-4-(dimethylamino)but-2-enamide |
| SMILES | CN(C)C/C=C/C(=O)Nc1ccccc1Nc1ncc(Br)c(Nc2ccc3ccccc3c2)n1 |
| InChI | InChI=1S/C26H25BrN6O/c1-33(2)15-7-12-24(34)30-22-10-5-6-11-23(22)31-26-28-17-21(27)25(32-26)29-20-14-13-18-8-3-4-9-19(18)16-20/h3-14,16-17H,15H2,1-2H3,(H,30,34)(H2,28,29,31,32)/b12-7+ |
| InChIKey | GRAGQNKVRJEAEK-KPKJPENVSA-N |
| XLogP | 5.94 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.43 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|