C27H27BrN6O — CID 140813150
(E)-N-[3-[[4-[(4-bromonaphthalen-2-yl)amino]pyrimidin-2-yl]amino]-5-methylphenyl]-4-(dimethylamino)but-2-enamide (PubChem CID 140813150) has the molecular formula C27H27BrN6O and a molecular weight of 531.46 g/mol. Its IUPAC name is (E)-N-[3-[[4-[(4-bromonaphthalen-2-yl)amino]pyrimidin-2-yl]amino]-5-methylphenyl]-4-(dimethylamino)but-2-enamide.
| Compound Name | (E)-N-[3-[[4-[(4-bromonaphthalen-2-yl)amino]pyrimidin-2-yl]amino]-5-methylphenyl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 140813150 |
| Molecular Formula | C27H27BrN6O |
| Molecular Weight | 531.46 g/mol |
| Exact Mass | 530.14 |
| IUPAC Name | (E)-N-[3-[[4-[(4-bromonaphthalen-2-yl)amino]pyrimidin-2-yl]amino]-5-methylphenyl]-4-(dimethylamino)but-2-enamide |
| SMILES | Cc1cc(NC(=O)/C=C/CN(C)C)cc(Nc2nccc(Nc3cc(Br)c4ccccc4c3)n2)c1 |
| InChI | InChI=1S/C27H27BrN6O/c1-18-13-20(31-26(35)9-6-12-34(2)3)16-21(14-18)32-27-29-11-10-25(33-27)30-22-15-19-7-4-5-8-23(19)24(28)17-22/h4-11,13-17H,12H2,1-3H3,(H,31,35)(H2,29,30,32,33)/b9-6+ |
| InChIKey | WNDFDQHTXPMGQN-RMKNXTFCSA-N |
| XLogP | 6.24 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.46 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|