C31H28FN7O2 — CID 139423012
3-[[(E)-4-(dimethylamino)but-2-enoyl]amino]-N-[3-[[4-(6-fluoroindol-1-yl)pyrimidin-2-yl]amino]phenyl]benzamide (PubChem CID 139423012) has the molecular formula C31H28FN7O2 and a molecular weight of 549.61 g/mol. Its IUPAC name is 3-[[(E)-4-(dimethylamino)but-2-enoyl]amino]-N-[3-[[4-(6-fluoroindol-1-yl)pyrimidin-2-yl]amino]phenyl]benzamide.
| Compound Name | 3-[[(E)-4-(dimethylamino)but-2-enoyl]amino]-N-[3-[[4-(6-fluoroindol-1-yl)pyrimidin-2-yl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 139423012 |
| Molecular Formula | C31H28FN7O2 |
| Molecular Weight | 549.61 g/mol |
| Exact Mass | 549.23 |
| IUPAC Name | 3-[[(E)-4-(dimethylamino)but-2-enoyl]amino]-N-[3-[[4-(6-fluoroindol-1-yl)pyrimidin-2-yl]amino]phenyl]benzamide |
| SMILES | CN(C)C/C=C/C(=O)Nc1cccc(C(=O)Nc2cccc(Nc3nccc(-n4ccc5ccc(F)cc54)n3)c2)c1 |
| InChI | InChI=1S/C31H28FN7O2/c1-38(2)16-5-10-29(40)34-24-7-3-6-22(18-24)30(41)35-25-8-4-9-26(20-25)36-31-33-15-13-28(37-31)39-17-14-21-11-12-23(32)19-27(21)39/h3-15,17-20H,16H2,1-2H3,(H,34,40)(H,35,41)(H,33,36,37)/b10-5+ |
| InChIKey | YQGGVYPIWFYTBJ-BJMVGYQFSA-N |
| XLogP | 5.61 |
| TPSA | 104.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.61 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|