C32H30ClN7O3 — CID 139423019
4-chloro-3-[[(E)-4-(dimethylamino)but-2-enoyl]amino]-N-[3-[[4-(4-methoxyindol-1-yl)pyrimidin-2-yl]amino]phenyl]benzamide (PubChem CID 139423019) has the molecular formula C32H30ClN7O3 and a molecular weight of 596.09 g/mol. Its IUPAC name is 4-chloro-3-[[(E)-4-(dimethylamino)but-2-enoyl]amino]-N-[3-[[4-(4-methoxyindol-1-yl)pyrimidin-2-yl]amino]phenyl]benzamide.
| Compound Name | 4-chloro-3-[[(E)-4-(dimethylamino)but-2-enoyl]amino]-N-[3-[[4-(4-methoxyindol-1-yl)pyrimidin-2-yl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 139423019 |
| Molecular Formula | C32H30ClN7O3 |
| Molecular Weight | 596.09 g/mol |
| Exact Mass | 595.21 |
| IUPAC Name | 4-chloro-3-[[(E)-4-(dimethylamino)but-2-enoyl]amino]-N-[3-[[4-(4-methoxyindol-1-yl)pyrimidin-2-yl]amino]phenyl]benzamide |
| SMILES | COc1cccc2c1ccn2-c1ccnc(Nc2cccc(NC(=O)c3ccc(Cl)c(NC(=O)/C=C/CN(C)C)c3)c2)n1 |
| InChI | InChI=1S/C32H30ClN7O3/c1-39(2)17-6-11-30(41)37-26-19-21(12-13-25(26)33)31(42)35-22-7-4-8-23(20-22)36-32-34-16-14-29(38-32)40-18-15-24-27(40)9-5-10-28(24)43-3/h4-16,18-20H,17H2,1-3H3,(H,35,42)(H,37,41)(H,34,36,38)/b11-6+ |
| InChIKey | ZHBAMSHJFOLWSF-IZZDOVSWSA-N |
| XLogP | 6.13 |
| TPSA | 113.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.09 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|