C26H21FN6O2 — CID 139423203
3-amino-N-[3-[[5-fluoro-4-(4-methoxyindol-1-yl)pyrimidin-2-yl]amino]phenyl]benzamide (PubChem CID 139423203) has the molecular formula C26H21FN6O2 and a molecular weight of 468.49 g/mol. Its IUPAC name is 3-amino-N-[3-[[5-fluoro-4-(4-methoxyindol-1-yl)pyrimidin-2-yl]amino]phenyl]benzamide.
| Compound Name | 3-amino-N-[3-[[5-fluoro-4-(4-methoxyindol-1-yl)pyrimidin-2-yl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 139423203 |
| Molecular Formula | C26H21FN6O2 |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 3-amino-N-[3-[[5-fluoro-4-(4-methoxyindol-1-yl)pyrimidin-2-yl]amino]phenyl]benzamide |
| SMILES | COc1cccc2c1ccn2-c1nc(Nc2cccc(NC(=O)c3cccc(N)c3)c2)ncc1F |
| InChI | InChI=1S/C26H21FN6O2/c1-35-23-10-4-9-22-20(23)11-12-33(22)24-21(27)15-29-26(32-24)31-19-8-3-7-18(14-19)30-25(34)16-5-2-6-17(28)13-16/h2-15H,28H2,1H3,(H,30,34)(H,29,31,32) |
| InChIKey | WKDDAYYFPXOIEO-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|