C23H17ClN4O — CID 46327430
N-(3-chlorophenyl)-4-[(6-phenylpyrimidin-4-yl)amino]benzamide (PubChem CID 46327430) has the molecular formula C23H17ClN4O and a molecular weight of 400.87 g/mol. Its IUPAC name is N-(3-chlorophenyl)-4-[(6-phenylpyrimidin-4-yl)amino]benzamide.
| Compound Name | N-(3-chlorophenyl)-4-[(6-phenylpyrimidin-4-yl)amino]benzamide |
|---|---|
| PubChem CID | 46327430 |
| Molecular Formula | C23H17ClN4O |
| Molecular Weight | 400.87 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | N-(3-chlorophenyl)-4-[(6-phenylpyrimidin-4-yl)amino]benzamide |
| SMILES | O=C(Nc1cccc(Cl)c1)c1ccc(Nc2cc(-c3ccccc3)ncn2)cc1 |
| InChI | InChI=1S/C23H17ClN4O/c24-18-7-4-8-20(13-18)28-23(29)17-9-11-19(12-10-17)27-22-14-21(25-15-26-22)16-5-2-1-3-6-16/h1-15H,(H,28,29)(H,25,26,27) |
| InChIKey | CYKKSWXMAPACBQ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.87 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |