C14H22BFN2O4S — CID 171591281
3-fluoro-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]propane-1-sulfonamide (PubChem CID 171591281) has the molecular formula C14H22BFN2O4S and a molecular weight of 344.22 g/mol. Its IUPAC name is 3-fluoro-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]propane-1-sulfonamide.
| Compound Name | 3-fluoro-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 171591281 |
| Molecular Formula | C14H22BFN2O4S |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 3-fluoro-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]propane-1-sulfonamide |
| SMILES | CC1(C)OB(c2ccc(NS(=O)(=O)CCCF)nc2)OC1(C)C |
| InChI | InChI=1S/C14H22BFN2O4S/c1-13(2)14(3,4)22-15(21-13)11-6-7-12(17-10-11)18-23(19,20)9-5-8-16/h6-7,10H,5,8-9H2,1-4H3,(H,17,18) |
| InChIKey | FVRNDGJYXKSKSF-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|