C17H27BClNO4S — CID 58873085
3-chloro-N-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]propane-1-sulfonamide (PubChem CID 58873085) has the molecular formula C17H27BClNO4S and a molecular weight of 387.74 g/mol. Its IUPAC name is 3-chloro-N-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]propane-1-sulfonamide.
| Compound Name | 3-chloro-N-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 58873085 |
| Molecular Formula | C17H27BClNO4S |
| Molecular Weight | 387.74 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 3-chloro-N-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]propane-1-sulfonamide |
| SMILES | CC1(C)OB(c2ccc(CCNS(=O)(=O)CCCCl)cc2)OC1(C)C |
| InChI | InChI=1S/C17H27BClNO4S/c1-16(2)17(3,4)24-18(23-16)15-8-6-14(7-9-15)10-12-20-25(21,22)13-5-11-19/h6-9,20H,5,10-13H2,1-4H3 |
| InChIKey | BWKIOSCEDTUEIF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.74 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|