C19H30BN3O5 — CID 163227582
[(2S)-2-[[3-(dimethylcarbamoyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]amino]propyl] acetate (PubChem CID 163227582) has the molecular formula C19H30BN3O5 and a molecular weight of 391.28 g/mol. Its IUPAC name is [(2S)-2-[[3-(dimethylcarbamoyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]amino]propyl] acetate.
| Compound Name | [(2S)-2-[[3-(dimethylcarbamoyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]amino]propyl] acetate |
|---|---|
| PubChem CID | 163227582 |
| Molecular Formula | C19H30BN3O5 |
| Molecular Weight | 391.28 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | [(2S)-2-[[3-(dimethylcarbamoyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]amino]propyl] acetate |
| SMILES | CC(=O)OC[C@H](C)Nc1ncc(B2OC(C)(C)C(C)(C)O2)cc1C(=O)N(C)C |
| InChI | InChI=1S/C19H30BN3O5/c1-12(11-26-13(2)24)22-16-15(17(25)23(7)8)9-14(10-21-16)20-27-18(3,4)19(5,6)28-20/h9-10,12H,11H2,1-8H3,(H,21,22)/t12-/m0/s1 |
| InChIKey | GBLZSHWZHLYNNL-LBPRGKRZSA-N |
| XLogP | 1.45 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.28 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|