C14H19BF2O4 — CID 171778050
5-(difluoromethoxy)-3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (PubChem CID 171778050) has the molecular formula C14H19BF2O4 and a molecular weight of 300.11 g/mol. Its IUPAC name is 5-(difluoromethoxy)-3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol.
| Compound Name | 5-(difluoromethoxy)-3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
|---|---|
| PubChem CID | 171778050 |
| Molecular Formula | C14H19BF2O4 |
| Molecular Weight | 300.11 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 5-(difluoromethoxy)-3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| SMILES | Cc1cc(OC(F)F)cc(O)c1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C14H19BF2O4/c1-8-6-9(19-12(16)17)7-10(18)11(8)15-20-13(2,3)14(4,5)21-15/h6-7,12,18H,1-5H3 |
| InChIKey | QDTHZMIWCKGSSX-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.11 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|