C14H21BN2O4 — CID 75487227
N-methoxy-N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxamide (PubChem CID 75487227) has the molecular formula C14H21BN2O4 and a molecular weight of 292.14 g/mol. Its IUPAC name is N-methoxy-N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxamide.
| Compound Name | N-methoxy-N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 75487227 |
| Molecular Formula | C14H21BN2O4 |
| Molecular Weight | 292.14 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | N-methoxy-N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxamide |
| SMILES | CON(C)C(=O)c1cccnc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C14H21BN2O4/c1-13(2)14(3,4)21-15(20-13)11-10(8-7-9-16-11)12(18)17(5)19-6/h7-9H,1-6H3 |
| InChIKey | GZAZMSYTIXESAK-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.14 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|