About 2-hydroxybenzoic acid;2-hydroxy-N-methoxy-N-methylbenzamide
2-hydroxybenzoic acid;2-hydroxy-N-methoxy-N-methylbenzamide (PubChem CID 158439697) has the molecular formula C16H17NO6
and a molecular weight of 319.31 g/mol. Its IUPAC name is 2-hydroxybenzoic acid;2-hydroxy-N-methoxy-N-methylbenzamide.
Molecular Properties
| Compound Name | 2-hydroxybenzoic acid;2-hydroxy-N-methoxy-N-methylbenzamide |
| PubChem CID | 158439697 |
| Molecular Formula | C16H17NO6 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 2-hydroxybenzoic acid;2-hydroxy-N-methoxy-N-methylbenzamide |
| SMILES | CON(C)C(=O)c1ccccc1O.O=C(O)c1ccccc1O |
| InChI | InChI=1S/C9H11NO3.C7H6O3/c1-10(13-2)9(12)7-5-3-4-6-8(7)11;8-6-4-2-1-3-5(6)7(9)10/h3-6,11H,1-2H3;1-4,8H,(H,9,10) |
| InChIKey | HCQVPCVAHRHKNA-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxybenzoic acid;2-hydroxy-N-methoxy-N-methylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxybenzoic acid;2-hydroxy-N-methoxy-N-methylbenzamide?
The IUPAC name of 2-hydroxybenzoic acid;2-hydroxy-N-methoxy-N-methylbenzamide (CID 158439697) is 2-hydroxybenzoic acid;2-hydroxy-N-methoxy-N-methylbenzamide.
What is the SMILES notation for 2-hydroxybenzoic acid;2-hydroxy-N-methoxy-N-methylbenzamide?
The canonical SMILES for 2-hydroxybenzoic acid;2-hydroxy-N-methoxy-N-methylbenzamide is CON(C)C(=O)c1ccccc1O.O=C(O)c1ccccc1O.
What is the InChIKey of 2-hydroxybenzoic acid;2-hydroxy-N-methoxy-N-methylbenzamide?
The InChIKey is HCQVPCVAHRHKNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO3.C7H6O3/c1-10(13-2)9(12)7-5-3-4-6-8(7)11;8-6-4-2-1-3-5(6)7(9)10/h3-6,11H,1-2H3;1-4,8H,(H,9,10).
What are the key properties of 2-hydroxybenzoic acid;2-hydroxy-N-methoxy-N-methylbenzamide?
2-hydroxybenzoic acid;2-hydroxy-N-methoxy-N-methylbenzamide has a molecular weight of 319.31 g/mol, XLogP of 2.12, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxybenzoic acid;2-hydroxy-N-methoxy-N-methylbenzamide is sourced from PubChem (CID 158439697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).