C14H20BFO4S — CID 86810536
2-[2-fluoro-3-(methylsulfonylmethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 86810536) has the molecular formula C14H20BFO4S and a molecular weight of 314.19 g/mol. Its IUPAC name is 2-[2-fluoro-3-(methylsulfonylmethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[2-fluoro-3-(methylsulfonylmethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 86810536 |
| Molecular Formula | C14H20BFO4S |
| Molecular Weight | 314.19 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 2-[2-fluoro-3-(methylsulfonylmethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2cccc(CS(C)(=O)=O)c2F)OC1(C)C |
| InChI | InChI=1S/C14H20BFO4S/c1-13(2)14(3,4)20-15(19-13)11-8-6-7-10(12(11)16)9-21(5,17)18/h6-8H,9H2,1-5H3 |
| InChIKey | PEZHOBHVLZQWOT-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.19 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|