C20H21BrFN3O2S — CID 10004719
4-bromo-1-(4-fluorophenyl)sulfonyl-3-[(4-methylpiperazin-1-yl)methyl]indole (PubChem CID 10004719) has the molecular formula C20H21BrFN3O2S and a molecular weight of 466.38 g/mol. Its IUPAC name is 4-bromo-1-(4-fluorophenyl)sulfonyl-3-[(4-methylpiperazin-1-yl)methyl]indole.
| Compound Name | 4-bromo-1-(4-fluorophenyl)sulfonyl-3-[(4-methylpiperazin-1-yl)methyl]indole |
|---|---|
| PubChem CID | 10004719 |
| Molecular Formula | C20H21BrFN3O2S |
| Molecular Weight | 466.38 g/mol |
| Exact Mass | 465.05 |
| IUPAC Name | 4-bromo-1-(4-fluorophenyl)sulfonyl-3-[(4-methylpiperazin-1-yl)methyl]indole |
| SMILES | CN1CCN(Cc2cn(S(=O)(=O)c3ccc(F)cc3)c3cccc(Br)c23)CC1 |
| InChI | InChI=1S/C20H21BrFN3O2S/c1-23-9-11-24(12-10-23)13-15-14-25(19-4-2-3-18(21)20(15)19)28(26,27)17-7-5-16(22)6-8-17/h2-8,14H,9-13H2,1H3 |
| InChIKey | SERXWDAUKDFLTJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |