C20H21BrN4O4S — CID 10480841
1-(2-bromophenyl)sulfonyl-3-[(4-methylpiperazin-1-yl)methyl]-5-nitroindole (PubChem CID 10480841) has the molecular formula C20H21BrN4O4S and a molecular weight of 493.38 g/mol. Its IUPAC name is 1-(2-bromophenyl)sulfonyl-3-[(4-methylpiperazin-1-yl)methyl]-5-nitroindole.
| Compound Name | 1-(2-bromophenyl)sulfonyl-3-[(4-methylpiperazin-1-yl)methyl]-5-nitroindole |
|---|---|
| PubChem CID | 10480841 |
| Molecular Formula | C20H21BrN4O4S |
| Molecular Weight | 493.38 g/mol |
| Exact Mass | 492.05 |
| IUPAC Name | 1-(2-bromophenyl)sulfonyl-3-[(4-methylpiperazin-1-yl)methyl]-5-nitroindole |
| SMILES | CN1CCN(Cc2cn(S(=O)(=O)c3ccccc3Br)c3ccc([N+](=O)[O-])cc23)CC1 |
| InChI | InChI=1S/C20H21BrN4O4S/c1-22-8-10-23(11-9-22)13-15-14-24(19-7-6-16(25(26)27)12-17(15)19)30(28,29)20-5-3-2-4-18(20)21/h2-7,12,14H,8-11,13H2,1H3 |
| InChIKey | PLLVYYHPNFOESC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 88.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|