C17H15ClN2O3S — CID 141293458
6-(4-chloroindol-1-yl)sulfonyl-4-methyl-2,3-dihydro-1,4-benzoxazine (PubChem CID 141293458) has the molecular formula C17H15ClN2O3S and a molecular weight of 362.84 g/mol. Its IUPAC name is 6-(4-chloroindol-1-yl)sulfonyl-4-methyl-2,3-dihydro-1,4-benzoxazine.
| Compound Name | 6-(4-chloroindol-1-yl)sulfonyl-4-methyl-2,3-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 141293458 |
| Molecular Formula | C17H15ClN2O3S |
| Molecular Weight | 362.84 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | 6-(4-chloroindol-1-yl)sulfonyl-4-methyl-2,3-dihydro-1,4-benzoxazine |
| SMILES | CN1CCOc2ccc(S(=O)(=O)n3ccc4c(Cl)cccc43)cc21 |
| InChI | InChI=1S/C17H15ClN2O3S/c1-19-9-10-23-17-6-5-12(11-16(17)19)24(21,22)20-8-7-13-14(18)3-2-4-15(13)20/h2-8,11H,9-10H2,1H3 |
| InChIKey | PMHPRZFBLVHJPZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.84 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |