About 4-benzyl-1-methylazepane
4-benzyl-1-methylazepane (PubChem CID 123177845) has the molecular formula C14H21N
and a molecular weight of 203.33 g/mol. Its IUPAC name is 4-benzyl-1-methylazepane.
Molecular Properties
| Compound Name | 4-benzyl-1-methylazepane |
| PubChem CID | 123177845 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 4-benzyl-1-methylazepane |
| SMILES | CN1CCCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C14H21N/c1-15-10-5-8-14(9-11-15)12-13-6-3-2-4-7-13/h2-4,6-7,14H,5,8-12H2,1H3 |
| InChIKey | MIESJRXOASDHLR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-benzyl-1-methylazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-1-methylazepane?
The IUPAC name of 4-benzyl-1-methylazepane (CID 123177845) is 4-benzyl-1-methylazepane.
What is the SMILES notation for 4-benzyl-1-methylazepane?
The canonical SMILES for 4-benzyl-1-methylazepane is CN1CCCC(Cc2ccccc2)CC1.
What is the InChIKey of 4-benzyl-1-methylazepane?
The InChIKey is MIESJRXOASDHLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N/c1-15-10-5-8-14(9-11-15)12-13-6-3-2-4-7-13/h2-4,6-7,14H,5,8-12H2,1H3.
What are the key properties of 4-benzyl-1-methylazepane?
4-benzyl-1-methylazepane has a molecular weight of 203.33 g/mol, XLogP of 2.96, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-1-methylazepane is sourced from PubChem (CID 123177845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).