C24H26BrN3O5S — CID 118648052
tert-butyl 4-[1-(3-bromophenyl)sulfonyl-3-formylindol-5-yl]piperazine-1-carboxylate (PubChem CID 118648052) has the molecular formula C24H26BrN3O5S and a molecular weight of 548.46 g/mol. Its IUPAC name is tert-butyl 4-[1-(3-bromophenyl)sulfonyl-3-formylindol-5-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-(3-bromophenyl)sulfonyl-3-formylindol-5-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 118648052 |
| Molecular Formula | C24H26BrN3O5S |
| Molecular Weight | 548.46 g/mol |
| Exact Mass | 547.08 |
| IUPAC Name | tert-butyl 4-[1-(3-bromophenyl)sulfonyl-3-formylindol-5-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc3c(c2)c(C=O)cn3S(=O)(=O)c2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C24H26BrN3O5S/c1-24(2,3)33-23(30)27-11-9-26(10-12-27)19-7-8-22-21(14-19)17(16-29)15-28(22)34(31,32)20-6-4-5-18(25)13-20/h4-8,13-16H,9-12H2,1-3H3 |
| InChIKey | OQUWRDHSUSIWDF-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 88.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.46 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|