C18H21ClFN5O3 — CID 91393324
N-(3-chloro-4-nitrophenyl)-1-methylpiperidine-4-carboxamide;5-fluoropyridin-2-amine (PubChem CID 91393324) has the molecular formula C18H21ClFN5O3 and a molecular weight of 409.85 g/mol. Its IUPAC name is N-(3-chloro-4-nitrophenyl)-1-methylpiperidine-4-carboxamide;5-fluoropyridin-2-amine.
| Compound Name | N-(3-chloro-4-nitrophenyl)-1-methylpiperidine-4-carboxamide;5-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 91393324 |
| Molecular Formula | C18H21ClFN5O3 |
| Molecular Weight | 409.85 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | N-(3-chloro-4-nitrophenyl)-1-methylpiperidine-4-carboxamide;5-fluoropyridin-2-amine |
| SMILES | CN1CCC(C(=O)Nc2ccc([N+](=O)[O-])c(Cl)c2)CC1.Nc1ccc(F)cn1 |
| InChI | InChI=1S/C13H16ClN3O3.C5H5FN2/c1-16-6-4-9(5-7-16)13(18)15-10-2-3-12(17(19)20)11(14)8-10;6-4-1-2-5(7)8-3-4/h2-3,8-9H,4-7H2,1H3,(H,15,18);1-3H,(H2,7,8) |
| InChIKey | FGVWDOGSCCGBRD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 114.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.85 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|