C13H21ClN4O3S — CID 119516492
N-(6-amino-3-pyridinyl)-1-ethylsulfonylpiperidine-4-carboxamide;hydrochloride (PubChem CID 119516492) has the molecular formula C13H21ClN4O3S and a molecular weight of 348.86 g/mol. Its IUPAC name is N-(6-amino-3-pyridinyl)-1-ethylsulfonylpiperidine-4-carboxamide;hydrochloride.
| Compound Name | N-(6-amino-3-pyridinyl)-1-ethylsulfonylpiperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119516492 |
| Molecular Formula | C13H21ClN4O3S |
| Molecular Weight | 348.86 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | N-(6-amino-3-pyridinyl)-1-ethylsulfonylpiperidine-4-carboxamide;hydrochloride |
| SMILES | CCS(=O)(=O)N1CCC(C(=O)Nc2ccc(N)nc2)CC1.Cl |
| InChI | InChI=1S/C13H20N4O3S.ClH/c1-2-21(19,20)17-7-5-10(6-8-17)13(18)16-11-3-4-12(14)15-9-11;/h3-4,9-10H,2,5-8H2,1H3,(H2,14,15)(H,16,18);1H |
| InChIKey | CLFBKQLYMISFBR-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.86 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |