C21H33N5O4S — CID 55971103
1-[5-[(1-butylsulfonylpiperidine-4-carbonyl)amino]-2-pyridinyl]piperidine-3-carboxamide (PubChem CID 55971103) has the molecular formula C21H33N5O4S and a molecular weight of 451.59 g/mol. Its IUPAC name is 1-[5-[(1-butylsulfonylpiperidine-4-carbonyl)amino]-2-pyridinyl]piperidine-3-carboxamide.
| Compound Name | 1-[5-[(1-butylsulfonylpiperidine-4-carbonyl)amino]-2-pyridinyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55971103 |
| Molecular Formula | C21H33N5O4S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | 1-[5-[(1-butylsulfonylpiperidine-4-carbonyl)amino]-2-pyridinyl]piperidine-3-carboxamide |
| SMILES | CCCCS(=O)(=O)N1CCC(C(=O)Nc2ccc(N3CCCC(C(N)=O)C3)nc2)CC1 |
| InChI | InChI=1S/C21H33N5O4S/c1-2-3-13-31(29,30)26-11-8-16(9-12-26)21(28)24-18-6-7-19(23-14-18)25-10-4-5-17(15-25)20(22)27/h6-7,14,16-17H,2-5,8-13,15H2,1H3,(H2,22,27)(H,24,28) |
| InChIKey | ZUJQEBDROZQZJD-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 125.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |